C10H16ClNO — CID 14657545
(NE)-N-[(1R,4S,6S)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine (PubChem CID 14657545) has the molecular formula C10H16ClNO and a molecular weight of 201.70 g/mol. Its IUPAC name is (NE)-N-[(1R,4S,6S)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine.
| Compound Name | (NE)-N-[(1R,4S,6S)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 14657545 |
| Molecular Formula | C10H16ClNO |
| Molecular Weight | 201.70 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (NE)-N-[(1R,4S,6S)-4-chloro-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine |
| SMILES | CC1(C)[C@@H]2C/C(=N\O)[C@@](C)(Cl)C[C@@H]21 |
| InChI | InChI=1S/C10H16ClNO/c1-9(2)6-4-8(12-13)10(3,11)5-7(6)9/h6-7,13H,4-5H2,1-3H3/b12-8+/t6-,7+,10+/m1/s1 |
| InChIKey | ZLBRJYIAHHOWDY-TUXQASCJSA-N |
| XLogP | 2.88 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.70 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|