C10H18N2O2 — CID 100819970
(NZ)-N-[(1S,4S,6S)-4-(hydroxyamino)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine (PubChem CID 100819970) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (NZ)-N-[(1S,4S,6S)-4-(hydroxyamino)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,4S,6S)-4-(hydroxyamino)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 100819970 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (NZ)-N-[(1S,4S,6S)-4-(hydroxyamino)-4,7,7-trimethyl-3-bicyclo[4.1.0]heptanylidene]hydroxylamine |
| SMILES | CC1(C)[C@H]2C/C(=N/O)[C@@](C)(NO)C[C@@H]21 |
| InChI | InChI=1S/C10H18N2O2/c1-9(2)6-4-8(11-13)10(3,12-14)5-7(6)9/h6-7,12-14H,4-5H2,1-3H3/b11-8-/t6-,7-,10-/m0/s1 |
| InChIKey | PQTBPHBYWMYLHI-XETKFQRFSA-N |
| XLogP | 1.62 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|