C16H14N4O2 — CID 146582267
N-hydroxy-2-(1H-indol-5-yl)-2,3-dihydro-1H-benzimidazole-5-carboxamide (PubChem CID 146582267) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is N-hydroxy-2-(1H-indol-5-yl)-2,3-dihydro-1H-benzimidazole-5-carboxamide.
| Compound Name | N-hydroxy-2-(1H-indol-5-yl)-2,3-dihydro-1H-benzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 146582267 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | N-hydroxy-2-(1H-indol-5-yl)-2,3-dihydro-1H-benzimidazole-5-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)NC(c1ccc3[nH]ccc3c1)N2 |
| InChI | InChI=1S/C16H14N4O2/c21-16(20-22)11-2-4-13-14(8-11)19-15(18-13)10-1-3-12-9(7-10)5-6-17-12/h1-8,15,17-19,22H,(H,20,21) |
| InChIKey | RHRFCMVBUZKVNG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|