3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid

C12H22O7 — CID 146586702

IUPAC3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid
SMILESCCC(CC(=O)OCC(CC(=O)O)(OC)OC)OC
InChIInChI=1S/C12H22O7/c1-5-9(16-2)6-11(15)19-8-12(17-3,18-4)7-10(13)14/h9H,5-8H2,1-4H3,(H,13,14)
InChIKeyFZZWCJDGDUHPJH-UHFFFAOYSA-N
MW278.30 g/mol
LogP0.81
Rot. Bonds10

About 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid

3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid (PubChem CID 146586702) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid.

Molecular Properties

Compound Name3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid
PubChem CID146586702
Molecular FormulaC12H22O7
Molecular Weight278.30 g/mol
Exact Mass278.14
IUPAC Name3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid
SMILESCCC(CC(=O)OCC(CC(=O)O)(OC)OC)OC
InChIInChI=1S/C12H22O7/c1-5-9(16-2)6-11(15)19-8-12(17-3,18-4)7-10(13)14/h9H,5-8H2,1-4H3,(H,13,14)
InChIKeyFZZWCJDGDUHPJH-UHFFFAOYSA-N
XLogP0.81
TPSA91.29 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds10
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.30
LogP ≤ 50.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-methoxyhexan-2-one;3-methoxypentanoic acid
CID 157200389
4-methoxy-2-oxohexanoic acid
CID 87467117
3-methoxypentanoic acid;pentanoic acid
CID 174739835
butan-1-ol;3-methoxypentanoic acid
CID 174606123
(3R)-3,5-dimethoxy-5-oxopentanoic acid
CID 14895219
(2R,6R)-2-hydroxy-6-methoxyoctan-4-one
CID 101412951
tert-butyl 4-amino-3-methoxybutanoate
CID 102921115
ethane;S-(2-methoxybutyl) carbamothioate
CID 144757844
3-ethyl-2-hydroxy-5-methoxy-4-methoxycarbonyl-5-oxopentane-1,2,3-tricarboxylic acid
CID 87386089
3-methoxypentanoic acid;styrene
CID 174406567
4-(2-aminobutanoylamino)-3-methoxybutanoic acid
CID 103157192
ethyl (3R,5S)-6-chloro-3,5-dimethoxyhexanoate
CID 141443052

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid?
The IUPAC name of 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid (CID 146586702) is 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid.
What is the SMILES notation for 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid?
The canonical SMILES for 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid is CCC(CC(=O)OCC(CC(=O)O)(OC)OC)OC.
What is the InChIKey of 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid?
The InChIKey is FZZWCJDGDUHPJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O7/c1-5-9(16-2)6-11(15)19-8-12(17-3,18-4)7-10(13)14/h9H,5-8H2,1-4H3,(H,13,14).
What are the key properties of 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid?
3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid has a molecular weight of 278.30 g/mol, XLogP of 0.81, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethoxy-4-(3-methoxypentanoyloxy)butanoic acid is sourced from PubChem (CID 146586702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).