C9H18FN — CID 146586946
(Z)-1-fluoro-N,N,5-trimethylhex-3-en-2-amine (PubChem CID 146586946) has the molecular formula C9H18FN and a molecular weight of 159.25 g/mol. Its IUPAC name is (Z)-1-fluoro-N,N,5-trimethylhex-3-en-2-amine.
| Compound Name | (Z)-1-fluoro-N,N,5-trimethylhex-3-en-2-amine |
|---|---|
| PubChem CID | 146586946 |
| Molecular Formula | C9H18FN |
| Molecular Weight | 159.25 g/mol |
| Exact Mass | 159.14 |
| IUPAC Name | (Z)-1-fluoro-N,N,5-trimethylhex-3-en-2-amine |
| SMILES | CC(C)/C=C\C(CF)N(C)C |
| InChI | InChI=1S/C9H18FN/c1-8(2)5-6-9(7-10)11(3)4/h5-6,8-9H,7H2,1-4H3/b6-5- |
| InChIKey | BXEOPKQRUJAURP-WAYWQWQTSA-N |
| XLogP | 2.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|