C21H23N7OS — CID 146587112
2-[2-[4-(4-sulfanylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one (PubChem CID 146587112) has the molecular formula C21H23N7OS and a molecular weight of 421.53 g/mol. Its IUPAC name is 2-[2-[4-(4-sulfanylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one.
| Compound Name | 2-[2-[4-(4-sulfanylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 146587112 |
| Molecular Formula | C21H23N7OS |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.17 |
| IUPAC Name | 2-[2-[4-(4-sulfanylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,5,6,7-tetrahydropyrrolo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCCc2[nH]c(-c3ccnc(Nc4ccc(N5CCN(S)CC5)cc4)n3)cc21 |
| InChI | InChI=1S/C21H23N7OS/c29-20-16-13-19(25-17(16)5-7-22-20)18-6-8-23-21(26-18)24-14-1-3-15(4-2-14)27-9-11-28(30)12-10-27/h1-4,6,8,13,25,30H,5,7,9-12H2,(H,22,29)(H,23,24,26) |
| InChIKey | XBPIQLMSYUMBCR-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|