C15H22N2O5 — CID 146594380
[2-(aminomethoxymethyl)-4-methoxy-3-pyridinyl]oxymethyl cyclopentanecarboxylate (PubChem CID 146594380) has the molecular formula C15H22N2O5 and a molecular weight of 310.35 g/mol. Its IUPAC name is [2-(aminomethoxymethyl)-4-methoxy-3-pyridinyl]oxymethyl cyclopentanecarboxylate.
| Compound Name | [2-(aminomethoxymethyl)-4-methoxy-3-pyridinyl]oxymethyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 146594380 |
| Molecular Formula | C15H22N2O5 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | [2-(aminomethoxymethyl)-4-methoxy-3-pyridinyl]oxymethyl cyclopentanecarboxylate |
| SMILES | COc1ccnc(COCN)c1OCOC(=O)C1CCCC1 |
| InChI | InChI=1S/C15H22N2O5/c1-19-13-6-7-17-12(8-20-9-16)14(13)21-10-22-15(18)11-4-2-3-5-11/h6-7,11H,2-5,8-10,16H2,1H3 |
| InChIKey | UPNOPIRASCRDJW-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|