C28H34F5N3O2 — CID 146603002
3-[(4R,6S)-3-[(1Z)-buta-1,3-dienyl]-4-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl]-2,2-difluoropropan-1-ol (PubChem CID 146603002) has the molecular formula C28H34F5N3O2 and a molecular weight of 539.59 g/mol. Its IUPAC name is 3-[(4R,6S)-3-[(1Z)-buta-1,3-dienyl]-4-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl]-2,2-difluoropropan-1-ol.
| Compound Name | 3-[(4R,6S)-3-[(1Z)-buta-1,3-dienyl]-4-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl]-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 146603002 |
| Molecular Formula | C28H34F5N3O2 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | 3-[(4R,6S)-3-[(1Z)-buta-1,3-dienyl]-4-[2,6-difluoro-4-[2-[3-(fluoromethyl)azetidin-1-yl]ethoxy]phenyl]-2,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridin-5-yl]-2,2-difluoropropan-1-ol |
| SMILES | C=C/C=C\c1c(C)[nH]c2c1[C@H](c1c(F)cc(OCCN3CC(CF)C3)cc1F)N(CC(F)(F)CO)[C@@H](C)C2 |
| InChI | InChI=1S/C28H34F5N3O2/c1-4-5-6-21-18(3)34-24-9-17(2)36(15-28(32,33)16-37)27(25(21)24)26-22(30)10-20(11-23(26)31)38-8-7-35-13-19(12-29)14-35/h4-6,10-11,17,19,27,34,37H,1,7-9,12-16H2,2-3H3/b6-5-/t17-,27+/m0/s1 |
| InChIKey | UQLQFUFVPXQJMH-FDRCBFGLSA-N |
| XLogP | 5.04 |
| TPSA | 51.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|