C24H27NO8 — CID 146603521
2-[(4S)-2-[2-[bis(phenylmethoxy)methylamino]ethyl]-1,3-dioxolan-4-yl]-3,4-dihydroxy-2H-furan-5-one (PubChem CID 146603521) has the molecular formula C24H27NO8 and a molecular weight of 457.48 g/mol. Its IUPAC name is 2-[(4S)-2-[2-[bis(phenylmethoxy)methylamino]ethyl]-1,3-dioxolan-4-yl]-3,4-dihydroxy-2H-furan-5-one.
| Compound Name | 2-[(4S)-2-[2-[bis(phenylmethoxy)methylamino]ethyl]-1,3-dioxolan-4-yl]-3,4-dihydroxy-2H-furan-5-one |
|---|---|
| PubChem CID | 146603521 |
| Molecular Formula | C24H27NO8 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 2-[(4S)-2-[2-[bis(phenylmethoxy)methylamino]ethyl]-1,3-dioxolan-4-yl]-3,4-dihydroxy-2H-furan-5-one |
| SMILES | O=C1OC([C@@H]2COC(CCNC(OCc3ccccc3)OCc3ccccc3)O2)C(O)=C1O |
| InChI | InChI=1S/C24H27NO8/c26-20-21(27)23(28)33-22(20)18-15-29-19(32-18)11-12-25-24(30-13-16-7-3-1-4-8-16)31-14-17-9-5-2-6-10-17/h1-10,18-19,22,24-27H,11-15H2/t18-,19?,22?/m0/s1 |
| InChIKey | JJXXTEICLDAOMY-PGFLUOATSA-N |
| XLogP | 2.68 |
| TPSA | 115.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|