C14H12N2O2S2 — CID 146606885
2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylidene-4H-isoquinolin-1-one (PubChem CID 146606885) has the molecular formula C14H12N2O2S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylidene-4H-isoquinolin-1-one.
| Compound Name | 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylidene-4H-isoquinolin-1-one |
|---|---|
| PubChem CID | 146606885 |
| Molecular Formula | C14H12N2O2S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 2-(2-oxo-6-sulfanylidenepiperidin-3-yl)-3-sulfanylidene-4H-isoquinolin-1-one |
| SMILES | O=C1NC(=S)CCC1N1C(=O)c2ccccc2CC1=S |
| InChI | InChI=1S/C14H12N2O2S2/c17-13-10(5-6-11(19)15-13)16-12(20)7-8-3-1-2-4-9(8)14(16)18/h1-4,10H,5-7H2,(H,15,17,19) |
| InChIKey | ANAGHSNBGOBBJE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|