About N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine
N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine (PubChem CID 146607019) has the molecular formula C12H25F2NO
and a molecular weight of 237.33 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine.
Molecular Properties
| Compound Name | N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine |
| PubChem CID | 146607019 |
| Molecular Formula | C12H25F2NO |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine |
| SMILES | CC(C)OCCC(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C12H25F2NO/c1-10(2)16-9-7-12(13,14)6-8-15-11(3,4)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | FUIZQKGCCUOJJX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine?
The IUPAC name of N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine (CID 146607019) is N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine.
What is the SMILES notation for N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine?
The canonical SMILES for N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine is CC(C)OCCC(F)(F)CCNC(C)(C)C.
What is the InChIKey of N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine?
The InChIKey is FUIZQKGCCUOJJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25F2NO/c1-10(2)16-9-7-12(13,14)6-8-15-11(3,4)5/h10,15H,6-9H2,1-5H3.
What are the key properties of N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine?
N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine has a molecular weight of 237.33 g/mol, XLogP of 3.21, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine is sourced from PubChem (CID 146607019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).