C12H25F2NO — CID 146607019
N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine (PubChem CID 146607019) has the molecular formula C12H25F2NO and a molecular weight of 237.33 g/mol. Its IUPAC name is N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine.
| Compound Name | N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine |
|---|---|
| PubChem CID | 146607019 |
| Molecular Formula | C12H25F2NO |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-tert-butyl-3,3-difluoro-5-propan-2-yloxypentan-1-amine |
| SMILES | CC(C)OCCC(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C12H25F2NO/c1-10(2)16-9-7-12(13,14)6-8-15-11(3,4)5/h10,15H,6-9H2,1-5H3 |
| InChIKey | FUIZQKGCCUOJJX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |