C15H32F2N2O — CID 118912802
N-tert-butyl-5-[2-(tert-butylamino)ethoxy]-3,3-difluoropentan-1-amine (PubChem CID 118912802) has the molecular formula C15H32F2N2O and a molecular weight of 294.43 g/mol. Its IUPAC name is N-tert-butyl-5-[2-(tert-butylamino)ethoxy]-3,3-difluoropentan-1-amine.
| Compound Name | N-tert-butyl-5-[2-(tert-butylamino)ethoxy]-3,3-difluoropentan-1-amine |
|---|---|
| PubChem CID | 118912802 |
| Molecular Formula | C15H32F2N2O |
| Molecular Weight | 294.43 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | N-tert-butyl-5-[2-(tert-butylamino)ethoxy]-3,3-difluoropentan-1-amine |
| SMILES | CC(C)(C)NCCOCCC(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C15H32F2N2O/c1-13(2,3)18-9-7-15(16,17)8-11-20-12-10-19-14(4,5)6/h18-19H,7-12H2,1-6H3 |
| InChIKey | RAPJYZHDQWHYDD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|