About 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine
5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine (PubChem CID 167254520) has the molecular formula C12H26F2N2O
and a molecular weight of 252.35 g/mol. Its IUPAC name is 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine.
Molecular Properties
| Compound Name | 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine |
| PubChem CID | 167254520 |
| Molecular Formula | C12H26F2N2O |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine |
| SMILES | CCC(C)(C)NCCC(F)(F)CCOCCN |
| InChI | InChI=1S/C12H26F2N2O/c1-4-11(2,3)16-8-5-12(13,14)6-9-17-10-7-15/h16H,4-10,15H2,1-3H3 |
| InChIKey | KRQDYWQYTZIEQZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine?
The IUPAC name of 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine (CID 167254520) is 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine.
What is the SMILES notation for 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine?
The canonical SMILES for 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine is CCC(C)(C)NCCC(F)(F)CCOCCN.
What is the InChIKey of 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine?
The InChIKey is KRQDYWQYTZIEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26F2N2O/c1-4-11(2,3)16-8-5-12(13,14)6-9-17-10-7-15/h16H,4-10,15H2,1-3H3.
What are the key properties of 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine?
5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine has a molecular weight of 252.35 g/mol, XLogP of 2.16, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine is sourced from PubChem (CID 167254520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).