C12H26F2N2O — CID 167254520
5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine (PubChem CID 167254520) has the molecular formula C12H26F2N2O and a molecular weight of 252.35 g/mol. Its IUPAC name is 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine.
| Compound Name | 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 167254520 |
| Molecular Formula | C12H26F2N2O |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 5-(2-aminoethoxy)-3,3-difluoro-N-(2-methylbutan-2-yl)pentan-1-amine |
| SMILES | CCC(C)(C)NCCC(F)(F)CCOCCN |
| InChI | InChI=1S/C12H26F2N2O/c1-4-11(2,3)16-8-5-12(13,14)6-9-17-10-7-15/h16H,4-10,15H2,1-3H3 |
| InChIKey | KRQDYWQYTZIEQZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|