C16H33F2NO — CID 157475293
N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine (PubChem CID 157475293) has the molecular formula C16H33F2NO and a molecular weight of 293.44 g/mol. Its IUPAC name is N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine.
| Compound Name | N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine |
|---|---|
| PubChem CID | 157475293 |
| Molecular Formula | C16H33F2NO |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-tert-butyl-5-(4,4-dimethylpentoxy)-3,3-difluoropentan-1-amine |
| SMILES | CC(C)(C)CCCOCCC(F)(F)CCNC(C)(C)C |
| InChI | InChI=1S/C16H33F2NO/c1-14(2,3)8-7-12-20-13-10-16(17,18)9-11-19-15(4,5)6/h19H,7-13H2,1-6H3 |
| InChIKey | LYRRLRXHSSGSSH-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|