C25H49NO — CID 146607046
5,9-dimethyl-7-pentadecan-8-yl-2-oxa-7-azaspiro[3.6]decane (PubChem CID 146607046) has the molecular formula C25H49NO and a molecular weight of 379.67 g/mol. Its IUPAC name is 5,9-dimethyl-7-pentadecan-8-yl-2-oxa-7-azaspiro[3.6]decane.
| Compound Name | 5,9-dimethyl-7-pentadecan-8-yl-2-oxa-7-azaspiro[3.6]decane |
|---|---|
| PubChem CID | 146607046 |
| Molecular Formula | C25H49NO |
| Molecular Weight | 379.67 g/mol |
| Exact Mass | 379.38 |
| IUPAC Name | 5,9-dimethyl-7-pentadecan-8-yl-2-oxa-7-azaspiro[3.6]decane |
| SMILES | CCCCCCCC(CCCCCCC)N1CC(C)CC2(COC2)C(C)C1 |
| InChI | InChI=1S/C25H49NO/c1-5-7-9-11-13-15-24(16-14-12-10-8-6-2)26-18-22(3)17-25(20-27-21-25)23(4)19-26/h22-24H,5-21H2,1-4H3 |
| InChIKey | HWVAUKNSGLFFQF-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.67 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|