About trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane
trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane (PubChem CID 146607253) has the molecular formula C16H32Cl6S6
and a molecular weight of 629.55 g/mol. Its IUPAC name is trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane.
Molecular Properties
| Compound Name | trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane |
| PubChem CID | 146607253 |
| Molecular Formula | C16H32Cl6S6 |
| Molecular Weight | 629.55 g/mol |
| Exact Mass | 625.90 |
| IUPAC Name | trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane |
| SMILES | CCC(CCCCSSSSCCCCC(CC)CS(Cl)(Cl)Cl)CS(Cl)(Cl)Cl |
| InChI | InChI=1S/C16H32Cl6S6/c1-3-15(13-27(17,18)19)9-5-7-11-23-25-26-24-12-8-6-10-16(4-2)14-28(20,21)22/h15-16H,3-14H2,1-2H3 |
| InChIKey | PFBGZFBXHJTNCR-UHFFFAOYSA-N |
| XLogP | 12.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 629.55 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane?
The IUPAC name of trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane (CID 146607253) is trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane.
What is the SMILES notation for trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane?
The canonical SMILES for trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane is CCC(CCCCSSSSCCCCC(CC)CS(Cl)(Cl)Cl)CS(Cl)(Cl)Cl.
What is the InChIKey of trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane?
The InChIKey is PFBGZFBXHJTNCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32Cl6S6/c1-3-15(13-27(17,18)19)9-5-7-11-23-25-26-24-12-8-6-10-16(4-2)14-28(20,21)22/h15-16H,3-14H2,1-2H3.
What are the key properties of trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane?
trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane has a molecular weight of 629.55 g/mol, XLogP of 12.59, 19 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trichloro-[2-ethyl-6-[5-[(trichloro-λ4-sulfanyl)methyl]heptyltetrasulfanyl]hexyl]-λ4-sulfane is sourced from PubChem (CID 146607253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).