C22H21BrO3 — CID 146608753
(3aS,9bR)-8-[(3-bromophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one (PubChem CID 146608753) has the molecular formula C22H21BrO3 and a molecular weight of 413.31 g/mol. Its IUPAC name is (3aS,9bR)-8-[(3-bromophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one.
| Compound Name | (3aS,9bR)-8-[(3-bromophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 146608753 |
| Molecular Formula | C22H21BrO3 |
| Molecular Weight | 413.31 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (3aS,9bR)-8-[(3-bromophenyl)methoxy]-6,9-dimethyl-3-methylidene-3a,4,5,9b-tetrahydrobenzo[g][1]benzofuran-2-one |
| SMILES | C=C1C(=O)O[C@H]2c3c(C)c(OCc4cccc(Br)c4)cc(C)c3CC[C@@H]12 |
| InChI | InChI=1S/C22H21BrO3/c1-12-9-19(25-11-15-5-4-6-16(23)10-15)14(3)20-17(12)7-8-18-13(2)22(24)26-21(18)20/h4-6,9-10,18,21H,2,7-8,11H2,1,3H3/t18-,21+/m0/s1 |
| InChIKey | MNINAUOKQCKKMG-GHTZIAJQSA-N |
| XLogP | 5.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.31 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|