C27H40N4O8S2 — CID 146611310
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-[2-hydroxy-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yl]-1,3-thiazol-5-yl]sulfonimidoyl]urea (PubChem CID 146611310) has the molecular formula C27H40N4O8S2 and a molecular weight of 612.77 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-[2-hydroxy-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yl]-1,3-thiazol-5-yl]sulfonimidoyl]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-[2-hydroxy-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yl]-1,3-thiazol-5-yl]sulfonimidoyl]urea |
|---|---|
| PubChem CID | 146611310 |
| Molecular Formula | C27H40N4O8S2 |
| Molecular Weight | 612.77 g/mol |
| Exact Mass | 612.23 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-[2-hydroxy-1-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]propan-2-yl]-1,3-thiazol-5-yl]sulfonimidoyl]urea |
| SMILES | [H]N=S(=O)(NC(=O)Nc1c2c(cc3c1CCC3)CCC2)c1cnc(C(C)(O)COCCOCCOCCOCCO)s1 |
| InChI | InChI=1S/C27H40N4O8S2/c1-27(34,18-39-15-14-38-13-12-37-11-10-36-9-8-32)25-29-17-23(40-25)41(28,35)31-26(33)30-24-21-6-2-4-19(21)16-20-5-3-7-22(20)24/h16-17,32,34H,2-15,18H2,1H3,(H3,28,30,31,33,35) |
| InChIKey | OCBQUPUDRYQJDC-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.77 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|