C12H20N4O3S — CID 146612218
[amino-[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]-oxo-λ6-sulfanylidene]urea (PubChem CID 146612218) has the molecular formula C12H20N4O3S and a molecular weight of 300.38 g/mol. Its IUPAC name is [amino-[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]-oxo-λ6-sulfanylidene]urea.
| Compound Name | [amino-[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]-oxo-λ6-sulfanylidene]urea |
|---|---|
| PubChem CID | 146612218 |
| Molecular Formula | C12H20N4O3S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | [amino-[4-[[2-methoxyethyl(methyl)amino]methyl]phenyl]-oxo-λ6-sulfanylidene]urea |
| SMILES | COCCN(C)Cc1ccc(S(N)(=O)=NC(N)=O)cc1 |
| InChI | InChI=1S/C12H20N4O3S/c1-16(7-8-19-2)9-10-3-5-11(6-4-10)20(14,18)15-12(13)17/h3-6H,7-9H2,1-2H3,(H4,13,14,15,17,18) |
| InChIKey | SSDCPGBMXQKROX-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |