C13H16FN — CID 146613019
3-fluoro-4-methyl-2,6-bis(prop-1-en-2-yl)aniline (PubChem CID 146613019) has the molecular formula C13H16FN and a molecular weight of 205.28 g/mol. Its IUPAC name is 3-fluoro-4-methyl-2,6-bis(prop-1-en-2-yl)aniline.
| Compound Name | 3-fluoro-4-methyl-2,6-bis(prop-1-en-2-yl)aniline |
|---|---|
| PubChem CID | 146613019 |
| Molecular Formula | C13H16FN |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | 3-fluoro-4-methyl-2,6-bis(prop-1-en-2-yl)aniline |
| SMILES | C=C(C)c1cc(C)c(F)c(C(=C)C)c1N |
| InChI | InChI=1S/C13H16FN/c1-7(2)10-6-9(5)12(14)11(8(3)4)13(10)15/h6H,1,3,15H2,2,4-5H3 |
| InChIKey | WLDQCGCOAKRHGJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|