C16H24O — CID 146614259
2-[[(2Z,4Z)-4-ethylhepta-2,4-dienoxy]methyl]cyclohexa-1,3-diene (PubChem CID 146614259) has the molecular formula C16H24O and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-[[(2Z,4Z)-4-ethylhepta-2,4-dienoxy]methyl]cyclohexa-1,3-diene.
| Compound Name | 2-[[(2Z,4Z)-4-ethylhepta-2,4-dienoxy]methyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 146614259 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | 2-[[(2Z,4Z)-4-ethylhepta-2,4-dienoxy]methyl]cyclohexa-1,3-diene |
| SMILES | CC/C=C(\C=C/COCC1=CCCC=C1)CC |
| InChI | InChI=1S/C16H24O/c1-3-9-15(4-2)12-8-13-17-14-16-10-6-5-7-11-16/h6,8-12H,3-5,7,13-14H2,1-2H3/b12-8-,15-9- |
| InChIKey | CCJSGZHNAJKMIZ-FFYBSVHWSA-N |
| XLogP | 4.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|