C17H26 — CID 91149267
2-(3-prop-1-enyloct-5-enyl)cyclohexa-1,3-diene (PubChem CID 91149267) has the molecular formula C17H26 and a molecular weight of 230.40 g/mol. Its IUPAC name is 2-(3-prop-1-enyloct-5-enyl)cyclohexa-1,3-diene.
| Compound Name | 2-(3-prop-1-enyloct-5-enyl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 91149267 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | 2-(3-prop-1-enyloct-5-enyl)cyclohexa-1,3-diene |
| SMILES | CC=CC(CC=CCC)CCC1=CCCC=C1 |
| InChI | InChI=1S/C17H26/c1-3-5-7-11-16(10-4-2)14-15-17-12-8-6-9-13-17/h4-5,7-8,10,12-13,16H,3,6,9,11,14-15H2,1-2H3 |
| InChIKey | PIVRIQYVMPOGPP-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|