C28H42 — CID 143978421
cyclohexa-1,3-diene;2-[(E)-3-ethenyl-7-(4-methylcyclohexyl)hept-5-enyl]cyclohexa-1,3-diene (PubChem CID 143978421) has the molecular formula C28H42 and a molecular weight of 378.64 g/mol. Its IUPAC name is cyclohexa-1,3-diene;2-[(E)-3-ethenyl-7-(4-methylcyclohexyl)hept-5-enyl]cyclohexa-1,3-diene.
| Compound Name | cyclohexa-1,3-diene;2-[(E)-3-ethenyl-7-(4-methylcyclohexyl)hept-5-enyl]cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143978421 |
| Molecular Formula | C28H42 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.33 |
| IUPAC Name | cyclohexa-1,3-diene;2-[(E)-3-ethenyl-7-(4-methylcyclohexyl)hept-5-enyl]cyclohexa-1,3-diene |
| SMILES | C1=CCCC=C1.C=CC(C/C=C/CC1CCC(C)CC1)CCC1=CCCC=C1 |
| InChI | InChI=1S/C22H34.C6H8/c1-3-20(17-18-21-10-5-4-6-11-21)9-7-8-12-22-15-13-19(2)14-16-22;1-2-4-6-5-3-1/h3,5,7-8,10-11,19-20,22H,1,4,6,9,12-18H2,2H3;1-4H,5-6H2/b8-7+; |
| InChIKey | SHBASCZSHVKDSC-USRGLUTNSA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|