C11H16O2 — CID 177027220
3-(cyclohexa-1,5-dien-1-ylmethoxy)cyclobutan-1-ol (PubChem CID 177027220) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-(cyclohexa-1,5-dien-1-ylmethoxy)cyclobutan-1-ol.
| Compound Name | 3-(cyclohexa-1,5-dien-1-ylmethoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 177027220 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | 3-(cyclohexa-1,5-dien-1-ylmethoxy)cyclobutan-1-ol |
| SMILES | OC1CC(OCC2=CCCC=C2)C1 |
| InChI | InChI=1S/C11H16O2/c12-10-6-11(7-10)13-8-9-4-2-1-3-5-9/h2,4-5,10-12H,1,3,6-8H2 |
| InChIKey | TWDORILQLLCZPU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |