C17H27NO3 — CID 169232118
N-[2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclopropyl]formamide;cyclohexanol (PubChem CID 169232118) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is N-[2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclopropyl]formamide;cyclohexanol.
| Compound Name | N-[2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclopropyl]formamide;cyclohexanol |
|---|---|
| PubChem CID | 169232118 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | N-[2-(cyclohexa-1,5-dien-1-ylmethoxy)cyclopropyl]formamide;cyclohexanol |
| SMILES | O=CNC1CC1OCC1=CCCC=C1.OC1CCCCC1 |
| InChI | InChI=1S/C11H15NO2.C6H12O/c13-8-12-10-6-11(10)14-7-9-4-2-1-3-5-9;7-6-4-2-1-3-5-6/h2,4-5,8,10-11H,1,3,6-7H2,(H,12,13);6-7H,1-5H2 |
| InChIKey | WVERTGPXNZUIOH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|