C5H7N3O2S2 — CID 146618917
1-[5-(aminosulfonimidoyl)-1,3-thiazol-2-yl]ethanone (PubChem CID 146618917) has the molecular formula C5H7N3O2S2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-[5-(aminosulfonimidoyl)-1,3-thiazol-2-yl]ethanone.
| Compound Name | 1-[5-(aminosulfonimidoyl)-1,3-thiazol-2-yl]ethanone |
|---|---|
| PubChem CID | 146618917 |
| Molecular Formula | C5H7N3O2S2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.00 |
| IUPAC Name | 1-[5-(aminosulfonimidoyl)-1,3-thiazol-2-yl]ethanone |
| SMILES | [H]N=S(N)(=O)c1cnc(C(C)=O)s1 |
| InChI | InChI=1S/C5H7N3O2S2/c1-3(9)5-8-2-4(11-5)12(6,7)10/h2H,1H3,(H3,6,7,10) |
| InChIKey | PZPVRHJBUMZWCE-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 96.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |