C21H36O3S — CID 146618937
4-(3,7,11-trimethyldodecan-2-yl)benzenesulfonic acid (PubChem CID 146618937) has the molecular formula C21H36O3S and a molecular weight of 368.58 g/mol. Its IUPAC name is 4-(3,7,11-trimethyldodecan-2-yl)benzenesulfonic acid.
| Compound Name | 4-(3,7,11-trimethyldodecan-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 146618937 |
| Molecular Formula | C21H36O3S |
| Molecular Weight | 368.58 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 4-(3,7,11-trimethyldodecan-2-yl)benzenesulfonic acid |
| SMILES | CC(C)CCCC(C)CCCC(C)C(C)c1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H36O3S/c1-16(2)8-6-9-17(3)10-7-11-18(4)19(5)20-12-14-21(15-13-20)25(22,23)24/h12-19H,6-11H2,1-5H3,(H,22,23,24) |
| InChIKey | MWWIAFCYMMOGKY-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.58 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|