C29H27NO3 — CID 146620058
3-[[2-[4-(4-butylphenyl)phenyl]acetyl]amino]naphthalene-2-carboxylic acid (PubChem CID 146620058) has the molecular formula C29H27NO3 and a molecular weight of 437.54 g/mol. Its IUPAC name is 3-[[2-[4-(4-butylphenyl)phenyl]acetyl]amino]naphthalene-2-carboxylic acid.
| Compound Name | 3-[[2-[4-(4-butylphenyl)phenyl]acetyl]amino]naphthalene-2-carboxylic acid |
|---|---|
| PubChem CID | 146620058 |
| Molecular Formula | C29H27NO3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 3-[[2-[4-(4-butylphenyl)phenyl]acetyl]amino]naphthalene-2-carboxylic acid |
| SMILES | CCCCc1ccc(-c2ccc(CC(=O)Nc3cc4ccccc4cc3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C29H27NO3/c1-2-3-6-20-9-13-22(14-10-20)23-15-11-21(12-16-23)17-28(31)30-27-19-25-8-5-4-7-24(25)18-26(27)29(32)33/h4-5,7-16,18-19H,2-3,6,17H2,1H3,(H,30,31)(H,32,33) |
| InChIKey | QKIWSXWPXOBQQH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |