C25H24ClNO3 — CID 146620035
2-[[2-[3-(4-butylphenyl)phenyl]acetyl]amino]-4-chlorobenzoic acid (PubChem CID 146620035) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is 2-[[2-[3-(4-butylphenyl)phenyl]acetyl]amino]-4-chlorobenzoic acid.
| Compound Name | 2-[[2-[3-(4-butylphenyl)phenyl]acetyl]amino]-4-chlorobenzoic acid |
|---|---|
| PubChem CID | 146620035 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 2-[[2-[3-(4-butylphenyl)phenyl]acetyl]amino]-4-chlorobenzoic acid |
| SMILES | CCCCc1ccc(-c2cccc(CC(=O)Nc3cc(Cl)ccc3C(=O)O)c2)cc1 |
| InChI | InChI=1S/C25H24ClNO3/c1-2-3-5-17-8-10-19(11-9-17)20-7-4-6-18(14-20)15-24(28)27-23-16-21(26)12-13-22(23)25(29)30/h4,6-14,16H,2-3,5,15H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | SIZAMNGDFJMBOC-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |