C18H20FN3O3S — CID 146621170
1-[5-(4-fluoroisoquinolin-5-yl)sulfonyl-6-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]ethanone (PubChem CID 146621170) has the molecular formula C18H20FN3O3S and a molecular weight of 377.44 g/mol. Its IUPAC name is 1-[5-(4-fluoroisoquinolin-5-yl)sulfonyl-6-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]ethanone.
| Compound Name | 1-[5-(4-fluoroisoquinolin-5-yl)sulfonyl-6-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]ethanone |
|---|---|
| PubChem CID | 146621170 |
| Molecular Formula | C18H20FN3O3S |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-[5-(4-fluoroisoquinolin-5-yl)sulfonyl-6-methyl-2,3,3a,4,6,6a-hexahydropyrrolo[3,4-b]pyrrol-1-yl]ethanone |
| SMILES | CC(=O)N1CCC2CN(S(=O)(=O)c3cccc4cncc(F)c34)C(C)C21 |
| InChI | InChI=1S/C18H20FN3O3S/c1-11-18-14(6-7-21(18)12(2)23)10-22(11)26(24,25)16-5-3-4-13-8-20-9-15(19)17(13)16/h3-5,8-9,11,14,18H,6-7,10H2,1-2H3 |
| InChIKey | VIRKJEKIHZAEDL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |