C18H38N4 — CID 146623964
1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diamine;1,2,2-trimethylcyclopentane-1,3-diamine (PubChem CID 146623964) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is 1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diamine;1,2,2-trimethylcyclopentane-1,3-diamine.
| Compound Name | 1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diamine;1,2,2-trimethylcyclopentane-1,3-diamine |
|---|---|
| PubChem CID | 146623964 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | 1,7,7-trimethylbicyclo[2.2.1]heptane-2,3-diamine;1,2,2-trimethylcyclopentane-1,3-diamine |
| SMILES | CC1(C)C2CCC1(C)C(N)C2N.CC1(N)CCC(N)C1(C)C |
| InChI | InChI=1S/C10H20N2.C8H18N2/c1-9(2)6-4-5-10(9,3)8(12)7(6)11;1-7(2)6(9)4-5-8(7,3)10/h6-8H,4-5,11-12H2,1-3H3;6H,4-5,9-10H2,1-3H3 |
| InChIKey | MRQDSJDXDZPKON-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |