C20H15ClF3N5O — CID 146624900
1-[3-[7-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]azetidin-1-yl]prop-2-en-1-one (PubChem CID 146624900) has the molecular formula C20H15ClF3N5O and a molecular weight of 433.82 g/mol. Its IUPAC name is 1-[3-[7-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]azetidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[7-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]azetidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146624900 |
| Molecular Formula | C20H15ClF3N5O |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | 1-[3-[7-[6-amino-3-(trifluoromethyl)-2-pyridinyl]-6-chloroquinazolin-4-yl]azetidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC(c2ncnc3cc(-c4nc(N)ccc4C(F)(F)F)c(Cl)cc23)C1 |
| InChI | InChI=1S/C20H15ClF3N5O/c1-2-17(30)29-7-10(8-29)18-12-5-14(21)11(6-15(12)26-9-27-18)19-13(20(22,23)24)3-4-16(25)28-19/h2-6,9-10H,1,7-8H2,(H2,25,28) |
| InChIKey | ONNUHFPTDRYAOH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|