C27H39N — CID 146635987
3,6-ditert-butyl-9-heptylcarbazole (PubChem CID 146635987) has the molecular formula C27H39N and a molecular weight of 377.62 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-heptylcarbazole.
| Compound Name | 3,6-ditert-butyl-9-heptylcarbazole |
|---|---|
| PubChem CID | 146635987 |
| Molecular Formula | C27H39N |
| Molecular Weight | 377.62 g/mol |
| Exact Mass | 377.31 |
| IUPAC Name | 3,6-ditert-butyl-9-heptylcarbazole |
| SMILES | CCCCCCCn1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C27H39N/c1-8-9-10-11-12-17-28-24-15-13-20(26(2,3)4)18-22(24)23-19-21(27(5,6)7)14-16-25(23)28/h13-16,18-19H,8-12,17H2,1-7H3 |
| InChIKey | YPBMSGDBCNNPKI-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.62 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|