C26H37N — CID 146671988
3,6-ditert-butyl-9-hexylcarbazole (PubChem CID 146671988) has the molecular formula C26H37N and a molecular weight of 363.59 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-hexylcarbazole.
| Compound Name | 3,6-ditert-butyl-9-hexylcarbazole |
|---|---|
| PubChem CID | 146671988 |
| Molecular Formula | C26H37N |
| Molecular Weight | 363.59 g/mol |
| Exact Mass | 363.29 |
| IUPAC Name | 3,6-ditert-butyl-9-hexylcarbazole |
| SMILES | CCCCCCn1c2ccc(C(C)(C)C)cc2c2cc(C(C)(C)C)ccc21 |
| InChI | InChI=1S/C26H37N/c1-8-9-10-11-16-27-23-14-12-19(25(2,3)4)17-21(23)22-18-20(26(5,6)7)13-15-24(22)27/h12-15,17-18H,8-11,16H2,1-7H3 |
| InChIKey | IDTLXZGSFGWHOL-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.59 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|