C16H27NO3 — CID 146637036
tert-butyl (3R,5E,7Z)-5-methyl-3-(methylcarbamoyl)nona-5,7-dienoate (PubChem CID 146637036) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl (3R,5E,7Z)-5-methyl-3-(methylcarbamoyl)nona-5,7-dienoate.
| Compound Name | tert-butyl (3R,5E,7Z)-5-methyl-3-(methylcarbamoyl)nona-5,7-dienoate |
|---|---|
| PubChem CID | 146637036 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl (3R,5E,7Z)-5-methyl-3-(methylcarbamoyl)nona-5,7-dienoate |
| SMILES | C/C=C\C=C(/C)C[C@H](CC(=O)OC(C)(C)C)C(=O)NC |
| InChI | InChI=1S/C16H27NO3/c1-7-8-9-12(2)10-13(15(19)17-6)11-14(18)20-16(3,4)5/h7-9,13H,10-11H2,1-6H3,(H,17,19)/b8-7-,12-9+/t13-/m1/s1 |
| InChIKey | MQLAMALQIWHONL-GSNYFQKJSA-N |
| XLogP | 2.99 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|