C17H19N5O — CID 146638308
N-cyclohexyl-5-imidazo[1,2-a]pyrazin-3-yl-1H-pyrrole-3-carboxamide (PubChem CID 146638308) has the molecular formula C17H19N5O and a molecular weight of 309.37 g/mol. Its IUPAC name is N-cyclohexyl-5-imidazo[1,2-a]pyrazin-3-yl-1H-pyrrole-3-carboxamide.
| Compound Name | N-cyclohexyl-5-imidazo[1,2-a]pyrazin-3-yl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 146638308 |
| Molecular Formula | C17H19N5O |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | N-cyclohexyl-5-imidazo[1,2-a]pyrazin-3-yl-1H-pyrrole-3-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1c[nH]c(-c2cnc3cnccn23)c1 |
| InChI | InChI=1S/C17H19N5O/c23-17(21-13-4-2-1-3-5-13)12-8-14(19-9-12)15-10-20-16-11-18-6-7-22(15)16/h6-11,13,19H,1-5H2,(H,21,23) |
| InChIKey | HPACRXYNJAHASQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |