C23H28N2O2 — CID 146640195
3-[[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]methyl]-N-[(Z,2E)-2-ethylidenepent-3-enyl]benzamide (PubChem CID 146640195) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 3-[[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]methyl]-N-[(Z,2E)-2-ethylidenepent-3-enyl]benzamide.
| Compound Name | 3-[[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]methyl]-N-[(Z,2E)-2-ethylidenepent-3-enyl]benzamide |
|---|---|
| PubChem CID | 146640195 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 3-[[[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]amino]methyl]-N-[(Z,2E)-2-ethylidenepent-3-enyl]benzamide |
| SMILES | C=C/C(=C\C=C/C)C(=O)NCc1cccc(C(=O)NCC(/C=C\C)=C/C)c1 |
| InChI | InChI=1S/C23H28N2O2/c1-5-9-13-20(8-4)22(26)25-17-19-12-10-14-21(15-19)23(27)24-16-18(7-3)11-6-2/h5-15H,4,16-17H2,1-3H3,(H,24,27)(H,25,26)/b9-5-,11-6-,18-7+,20-13+ |
| InChIKey | ZWAFXLUAMHUPBD-PIOJTZMDSA-N |
| XLogP | 4.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|