C22H22F3N3O2S — CID 146648656
1-(4-methylphenyl)-5-sulfanylidene-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]pyrrolidin-2-one (PubChem CID 146648656) has the molecular formula C22H22F3N3O2S and a molecular weight of 449.50 g/mol. Its IUPAC name is 1-(4-methylphenyl)-5-sulfanylidene-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]pyrrolidin-2-one.
| Compound Name | 1-(4-methylphenyl)-5-sulfanylidene-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 146648656 |
| Molecular Formula | C22H22F3N3O2S |
| Molecular Weight | 449.50 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 1-(4-methylphenyl)-5-sulfanylidene-3-[4-[4-(trifluoromethoxy)phenyl]piperazin-1-yl]pyrrolidin-2-one |
| SMILES | Cc1ccc(N2C(=O)C(N3CCN(c4ccc(OC(F)(F)F)cc4)CC3)CC2=S)cc1 |
| InChI | InChI=1S/C22H22F3N3O2S/c1-15-2-4-17(5-3-15)28-20(31)14-19(21(28)29)27-12-10-26(11-13-27)16-6-8-18(9-7-16)30-22(23,24)25/h2-9,19H,10-14H2,1H3 |
| InChIKey | XBTUWNTYFHEBJC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.50 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|