C23H26F3N3O — CID 155274276
1-[2-methylidene-1-(4-methylphenyl)pyrrolidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]piperazine (PubChem CID 155274276) has the molecular formula C23H26F3N3O and a molecular weight of 417.48 g/mol. Its IUPAC name is 1-[2-methylidene-1-(4-methylphenyl)pyrrolidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]piperazine.
| Compound Name | 1-[2-methylidene-1-(4-methylphenyl)pyrrolidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 155274276 |
| Molecular Formula | C23H26F3N3O |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 1-[2-methylidene-1-(4-methylphenyl)pyrrolidin-3-yl]-4-[4-(trifluoromethoxy)phenyl]piperazine |
| SMILES | C=C1C(N2CCN(c3ccc(OC(F)(F)F)cc3)CC2)CCN1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H26F3N3O/c1-17-3-5-20(6-4-17)29-12-11-22(18(29)2)28-15-13-27(14-16-28)19-7-9-21(10-8-19)30-23(24,25)26/h3-10,22H,2,11-16H2,1H3 |
| InChIKey | OQHSNYPEVWHIIM-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|