C20H15ClFN7O2 — CID 146650920
5-chloro-2-(3-fluorophenyl)-2-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-1,3-dihydropyrido[2,1-f][1,2,4]triazine-4,8-dione (PubChem CID 146650920) has the molecular formula C20H15ClFN7O2 and a molecular weight of 439.84 g/mol. Its IUPAC name is 5-chloro-2-(3-fluorophenyl)-2-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-1,3-dihydropyrido[2,1-f][1,2,4]triazine-4,8-dione.
| Compound Name | 5-chloro-2-(3-fluorophenyl)-2-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-1,3-dihydropyrido[2,1-f][1,2,4]triazine-4,8-dione |
|---|---|
| PubChem CID | 146650920 |
| Molecular Formula | C20H15ClFN7O2 |
| Molecular Weight | 439.84 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | 5-chloro-2-(3-fluorophenyl)-2-methyl-7-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)-1,3-dihydropyrido[2,1-f][1,2,4]triazine-4,8-dione |
| SMILES | CC1(c2cccc(F)c2)NC(=O)c2c(Cl)cc(Nc3ncnc4[nH]ccc34)c(=O)n2N1 |
| InChI | InChI=1S/C20H15ClFN7O2/c1-20(10-3-2-4-11(22)7-10)27-18(30)15-13(21)8-14(19(31)29(15)28-20)26-17-12-5-6-23-16(12)24-9-25-17/h2-9,28H,1H3,(H,27,30)(H2,23,24,25,26) |
| InChIKey | GTEHLGLDMBVAQZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 116.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.84 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |