C17H17NO4 — CID 146652782
methyl (2R,3R)-2-[(E)-2-(1H-indol-3-yl)ethenyl]-4-oxooxane-3-carboxylate (PubChem CID 146652782) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is methyl (2R,3R)-2-[(E)-2-(1H-indol-3-yl)ethenyl]-4-oxooxane-3-carboxylate.
| Compound Name | methyl (2R,3R)-2-[(E)-2-(1H-indol-3-yl)ethenyl]-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 146652782 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | methyl (2R,3R)-2-[(E)-2-(1H-indol-3-yl)ethenyl]-4-oxooxane-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)CCO[C@@H]1/C=C/c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H17NO4/c1-21-17(20)16-14(19)8-9-22-15(16)7-6-11-10-18-13-5-3-2-4-12(11)13/h2-7,10,15-16,18H,8-9H2,1H3/b7-6+/t15-,16+/m1/s1 |
| InChIKey | NWEBZDGNYRCBTD-ZWOPJXCPSA-N |
| XLogP | 2.33 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|