C31H45N7O5 — CID 146656883
6-[[(1S,2R)-2-aminocyclohexyl]amino]-2-[[7-(5-morpholin-4-yl-7-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl)-2,3-dihydro-1H-indol-5-yl]amino]piperidine-3-carboxamide (PubChem CID 146656883) has the molecular formula C31H45N7O5 and a molecular weight of 595.75 g/mol. Its IUPAC name is 6-[[(1S,2R)-2-aminocyclohexyl]amino]-2-[[7-(5-morpholin-4-yl-7-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl)-2,3-dihydro-1H-indol-5-yl]amino]piperidine-3-carboxamide.
| Compound Name | 6-[[(1S,2R)-2-aminocyclohexyl]amino]-2-[[7-(5-morpholin-4-yl-7-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl)-2,3-dihydro-1H-indol-5-yl]amino]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 146656883 |
| Molecular Formula | C31H45N7O5 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.35 |
| IUPAC Name | 6-[[(1S,2R)-2-aminocyclohexyl]amino]-2-[[7-(5-morpholin-4-yl-7-oxo-2,3,3a,7a-tetrahydrofuro[3,2-b]pyran-3-yl)-2,3-dihydro-1H-indol-5-yl]amino]piperidine-3-carboxamide |
| SMILES | NC(=O)C1CCC(N[C@H]2CCCC[C@H]2N)NC1Nc1cc2c(c(C3COC4C(=O)C=C(N5CCOCC5)OC43)c1)NCC2 |
| InChI | InChI=1S/C31H45N7O5/c32-22-3-1-2-4-23(22)36-25-6-5-19(30(33)40)31(37-25)35-18-13-17-7-8-34-27(17)20(14-18)21-16-42-29-24(39)15-26(43-28(21)29)38-9-11-41-12-10-38/h13-15,19,21-23,25,28-29,31,34-37H,1-12,16,32H2,(H2,33,40)/t19?,21?,22-,23+,25?,28?,29?,31?/m1/s1 |
| InChIKey | SGEHWWAXYRZYKK-RDTJWJEGSA-N |
| XLogP | 0.69 |
| TPSA | 165.23 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |