C13H17N7O4 — CID 146657538
(5R)-11-(azidomethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid (PubChem CID 146657538) has the molecular formula C13H17N7O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is (5R)-11-(azidomethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid.
| Compound Name | (5R)-11-(azidomethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid |
|---|---|
| PubChem CID | 146657538 |
| Molecular Formula | C13H17N7O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | (5R)-11-(azidomethyl)-5,13-dimethyl-14-oxo-12-oxa-4,8,9,13-tetrazatricyclo[7.5.0.02,7]tetradeca-1,7-diene-4-carboxylic acid |
| SMILES | C[C@@H]1Cc2nn3c(c2CN1C(=O)O)C(=O)N(C)OC(CN=[N+]=[N-])C3 |
| InChI | InChI=1S/C13H17N7O4/c1-7-3-10-9(6-19(7)13(22)23)11-12(21)18(2)24-8(4-15-17-14)5-20(11)16-10/h7-8H,3-6H2,1-2H3,(H,22,23)/t7-,8?/m1/s1 |
| InChIKey | IVYLKDBYGYLQQV-GVHYBUMESA-N |
| XLogP | 1.00 |
| TPSA | 136.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|