C22H19Cl2N3O5S — CID 146660774
N-[(3,4-dichlorophenyl)methyl]-2-[[2-(4-hydroxyanilino)-2-oxoethyl]sulfamoyl]benzamide (PubChem CID 146660774) has the molecular formula C22H19Cl2N3O5S and a molecular weight of 508.38 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-[[2-(4-hydroxyanilino)-2-oxoethyl]sulfamoyl]benzamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-[[2-(4-hydroxyanilino)-2-oxoethyl]sulfamoyl]benzamide |
|---|---|
| PubChem CID | 146660774 |
| Molecular Formula | C22H19Cl2N3O5S |
| Molecular Weight | 508.38 g/mol |
| Exact Mass | 507.04 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-[[2-(4-hydroxyanilino)-2-oxoethyl]sulfamoyl]benzamide |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1C(=O)NCc1ccc(Cl)c(Cl)c1)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C22H19Cl2N3O5S/c23-18-10-5-14(11-19(18)24)12-25-22(30)17-3-1-2-4-20(17)33(31,32)26-13-21(29)27-15-6-8-16(28)9-7-15/h1-11,26,28H,12-13H2,(H,25,30)(H,27,29) |
| InChIKey | GZMNVGLLXJLTLY-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 124.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|