C21H16Cl2N2O5S — CID 46880353
2-[[2-[4-(3,4-dichlorophenyl)anilino]-2-oxoethyl]sulfamoyl]benzoic acid (PubChem CID 46880353) has the molecular formula C21H16Cl2N2O5S and a molecular weight of 479.34 g/mol. Its IUPAC name is 2-[[2-[4-(3,4-dichlorophenyl)anilino]-2-oxoethyl]sulfamoyl]benzoic acid.
| Compound Name | 2-[[2-[4-(3,4-dichlorophenyl)anilino]-2-oxoethyl]sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 46880353 |
| Molecular Formula | C21H16Cl2N2O5S |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.02 |
| IUPAC Name | 2-[[2-[4-(3,4-dichlorophenyl)anilino]-2-oxoethyl]sulfamoyl]benzoic acid |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1C(=O)O)Nc1ccc(-c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C21H16Cl2N2O5S/c22-17-10-7-14(11-18(17)23)13-5-8-15(9-6-13)25-20(26)12-24-31(29,30)19-4-2-1-3-16(19)21(27)28/h1-11,24H,12H2,(H,25,26)(H,27,28) |
| InChIKey | DETCJXKUURQYRY-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |