About (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide
(E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide (PubChem CID 146661343) has the molecular formula C19H19NO2
and a molecular weight of 293.37 g/mol. Its IUPAC name is (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide.
Molecular Properties
| Compound Name | (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide |
| PubChem CID | 146661343 |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(c1ccccc1)C1CCOC1 |
| InChI | InChI=1S/C19H19NO2/c21-19(12-11-16-7-3-1-4-8-16)20(18-13-14-22-15-18)17-9-5-2-6-10-17/h1-12,18H,13-15H2/b12-11+ |
| InChIKey | CUUQSVICMVXPCN-VAWYXSNFSA-N |
| XLogP | 3.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide?
The IUPAC name of (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide (CID 146661343) is (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide.
What is the SMILES notation for (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide?
The canonical SMILES for (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide is O=C(/C=C/c1ccccc1)N(c1ccccc1)C1CCOC1.
What is the InChIKey of (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide?
The InChIKey is CUUQSVICMVXPCN-VAWYXSNFSA-N. The full InChI is InChI=1S/C19H19NO2/c21-19(12-11-16-7-3-1-4-8-16)20(18-13-14-22-15-18)17-9-5-2-6-10-17/h1-12,18H,13-15H2/b12-11+.
What are the key properties of (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide?
(E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide has a molecular weight of 293.37 g/mol, XLogP of 3.52, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(oxolan-3-yl)-N,3-diphenylprop-2-enamide is sourced from PubChem (CID 146661343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).