C23H23ClN2O3 — CID 146663768
9H-fluoren-9-yl N-[2-amino-2-(4-hydroxyphenyl)ethyl]-N-methylcarbamate;hydrochloride (PubChem CID 146663768) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 9H-fluoren-9-yl N-[2-amino-2-(4-hydroxyphenyl)ethyl]-N-methylcarbamate;hydrochloride.
| Compound Name | 9H-fluoren-9-yl N-[2-amino-2-(4-hydroxyphenyl)ethyl]-N-methylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 146663768 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 9H-fluoren-9-yl N-[2-amino-2-(4-hydroxyphenyl)ethyl]-N-methylcarbamate;hydrochloride |
| SMILES | CN(CC(N)c1ccc(O)cc1)C(=O)OC1c2ccccc2-c2ccccc21.Cl |
| InChI | InChI=1S/C23H22N2O3.ClH/c1-25(14-21(24)15-10-12-16(26)13-11-15)23(27)28-22-19-8-4-2-6-17(19)18-7-3-5-9-20(18)22;/h2-13,21-22,26H,14,24H2,1H3;1H |
| InChIKey | BWDKBZPMWONGHB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |