C34H22BrN3O2 — CID 146666293
2-[4-(7-bromo-8-methyldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 146666293) has the molecular formula C34H22BrN3O2 and a molecular weight of 584.47 g/mol. Its IUPAC name is 2-[4-(7-bromo-8-methyldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-(7-bromo-8-methyldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 146666293 |
| Molecular Formula | C34H22BrN3O2 |
| Molecular Weight | 584.47 g/mol |
| Exact Mass | 583.09 |
| IUPAC Name | 2-[4-(7-bromo-8-methyldibenzo-p-dioxin-2-yl)phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | Cc1cc2c(cc1Br)Oc1ccc(-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)cc3)cc1O2 |
| InChI | InChI=1S/C34H22BrN3O2/c1-21-18-29-31(20-27(21)35)39-28-17-16-26(19-30(28)40-29)22-12-14-25(15-13-22)34-37-32(23-8-4-2-5-9-23)36-33(38-34)24-10-6-3-7-11-24/h2-20H,1H3 |
| InChIKey | RKKZLFKEAVHAAI-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.47 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |