About ethane;methanamine;2-phenyldibenzo-p-dioxin
ethane;methanamine;2-phenyldibenzo-p-dioxin (PubChem CID 144875802) has the molecular formula C21H23NO2
and a molecular weight of 321.42 g/mol. Its IUPAC name is ethane;methanamine;2-phenyldibenzo-p-dioxin.
Molecular Properties
| Compound Name | ethane;methanamine;2-phenyldibenzo-p-dioxin |
| PubChem CID | 144875802 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | ethane;methanamine;2-phenyldibenzo-p-dioxin |
| SMILES | CC.CN.c1ccc(-c2ccc3c(c2)Oc2ccccc2O3)cc1 |
| InChI | InChI=1S/C18H12O2.C2H6.CH5N/c1-2-6-13(7-3-1)14-10-11-17-18(12-14)20-16-9-5-4-8-15(16)19-17;2*1-2/h1-12H;1-2H3;2H2,1H3 |
| InChIKey | CJMVWXRLFSCNPG-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;methanamine;2-phenyldibenzo-p-dioxin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;2-phenyldibenzo-p-dioxin?
The IUPAC name of ethane;methanamine;2-phenyldibenzo-p-dioxin (CID 144875802) is ethane;methanamine;2-phenyldibenzo-p-dioxin.
What is the SMILES notation for ethane;methanamine;2-phenyldibenzo-p-dioxin?
The canonical SMILES for ethane;methanamine;2-phenyldibenzo-p-dioxin is CC.CN.c1ccc(-c2ccc3c(c2)Oc2ccccc2O3)cc1.
What is the InChIKey of ethane;methanamine;2-phenyldibenzo-p-dioxin?
The InChIKey is CJMVWXRLFSCNPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12O2.C2H6.CH5N/c1-2-6-13(7-3-1)14-10-11-17-18(12-14)20-16-9-5-4-8-15(16)19-17;2*1-2/h1-12H;1-2H3;2H2,1H3.
What are the key properties of ethane;methanamine;2-phenyldibenzo-p-dioxin?
ethane;methanamine;2-phenyldibenzo-p-dioxin has a molecular weight of 321.42 g/mol, XLogP of 5.85, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;2-phenyldibenzo-p-dioxin is sourced from PubChem (CID 144875802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).