About 3-phenyl-9H-xanthen-9-ol
3-phenyl-9H-xanthen-9-ol (PubChem CID 15685341) has the molecular formula C19H14O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-phenyl-9H-xanthen-9-ol.
Molecular Properties
| Compound Name | 3-phenyl-9H-xanthen-9-ol |
| PubChem CID | 15685341 |
| Molecular Formula | C19H14O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 3-phenyl-9H-xanthen-9-ol |
| SMILES | OC1c2ccccc2Oc2cc(-c3ccccc3)ccc21 |
| InChI | InChI=1S/C19H14O2/c20-19-15-8-4-5-9-17(15)21-18-12-14(10-11-16(18)19)13-6-2-1-3-7-13/h1-12,19-20H |
| InChIKey | RVKXYIJDHZARCO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-phenyl-9H-xanthen-9-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-9H-xanthen-9-ol?
The IUPAC name of 3-phenyl-9H-xanthen-9-ol (CID 15685341) is 3-phenyl-9H-xanthen-9-ol.
What is the SMILES notation for 3-phenyl-9H-xanthen-9-ol?
The canonical SMILES for 3-phenyl-9H-xanthen-9-ol is OC1c2ccccc2Oc2cc(-c3ccccc3)ccc21.
What is the InChIKey of 3-phenyl-9H-xanthen-9-ol?
The InChIKey is RVKXYIJDHZARCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O2/c20-19-15-8-4-5-9-17(15)21-18-12-14(10-11-16(18)19)13-6-2-1-3-7-13/h1-12,19-20H.
What are the key properties of 3-phenyl-9H-xanthen-9-ol?
3-phenyl-9H-xanthen-9-ol has a molecular weight of 274.32 g/mol, XLogP of 4.54, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-9H-xanthen-9-ol is sourced from PubChem (CID 15685341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).